Online Database of Chemicals from Around the World
|
CAS#: 65596-25-0 Product: Bacchotricuneatin A No suppilers available for the product. |
| Name | Bacchotricuneatin A |
|---|---|
| Synonyms | Bacchotricuneatin A; Nsc299115 |
| Molecular Structure |  |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 |
| CAS Registry Number | 65596-25-0 |
| SMILES | C5=C(C4OC(=O)C3C(C1C2(C(=CCC1)C(OC2)=O)CC3)(C4)C)C=CO5 |
| InChI | 1S/C20H22O5/c1-19-9-15(12-6-8-23-10-12)25-18(22)13(19)5-7-20-11-24-17(21)14(20)3-2-4-16(19)20/h3,6,8,10,13,15-16H,2,4-5,7,9,11H2,1H3 |
| InChIKey | BLXXJMVVAYFKDR-UHFFFAOYSA-N |
| Density | 1.312g/cm3 (Cal.) |
|---|---|
| Boiling point | 587.08°C at 760 mmHg (Cal.) |
| Flash point | 308.855°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bacchotricuneatin A |