Online Database of Chemicals from Around the World
|
CAS#: 65625-34-5 Product: 7-Hydroxy-3'-Methoxyflavone No suppilers available for the product. |
| Name | 7-Hydroxy-3'-Methoxyflavone |
|---|---|
| Synonyms | 7-Hydroxy-3-Methoxy-2-Phenyl-Chromen-4-One; 7-Hydroxy-3-Methoxy-2-Phenyl-4-Chromenone; 7-Hydroxy-3-Methoxy-2-Phenyl-Chromone |
| Molecular Structure |  |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 |
| CAS Registry Number | 65625-34-5 |
| SMILES | C1=C2C(=CC=C1O)C(C(=C(O2)C3=CC=CC=C3)OC)=O |
| InChI | 1S/C16H12O4/c1-19-16-14(18)12-8-7-11(17)9-13(12)20-15(16)10-5-3-2-4-6-10/h2-9,17H,1H3 |
| InChIKey | IDNRUSTZBHNIHZ-UHFFFAOYSA-N |
| Density | 1.367g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.014°C at 760 mmHg (Cal.) |
| Flash point | 186.641°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Hydroxy-3'-Methoxyflavone |