Online Database of Chemicals from Around the World
|
CAS#: 65708-37-4 Product: Flufosal No suppilers available for the product. |
| Name | Flufosal |
|---|---|
| Synonyms | Alpha,Alpha,Alpha-Trifluoro-2,4-Cresotic Acid Dihydrogen Phosphate; Flufosal; Flufosal [Inn] |
| Molecular Structure |  |
| Molecular Formula | C8H6F3O6P |
| Molecular Weight | 286.10 |
| CAS Registry Number | 65708-37-4 |
| SMILES | C1=C(C(=CC=C1C(F)(F)F)C(O)=O)O[P](O)(O)=O |
| InChI | 1S/C8H6F3O6P/c9-8(10,11)4-1-2-5(7(12)13)6(3-4)17-18(14,15)16/h1-3H,(H,12,13)(H2,14,15,16) |
| InChIKey | XOJUWOHYUFBSKE-UHFFFAOYSA-N |
| Density | 1.765g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.612°C at 760 mmHg (Cal.) |
| Flash point | 226.322°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Flufosal |