Online Database of Chemicals from Around the World
| Name | 1,2,3,4,5,10B-Hexahydropyrido(2,3-g)Indolizine |
|---|---|
| Synonyms | Pyrrolo(2,1-F)(1,6)Naphthyridine, 5,6,8,9,10,10A-Hexahydro-, (+-)-; 1,2,3,4,5,10B-Hexahydropyrido(2,3-G)Indolizine; Hhpi |
| Molecular Structure |  |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 |
| CAS Registry Number | 65719-07-5 |
| SMILES | C1=NC2=C(C=C1)C3N(CC2)CCC3 |
| InChI | 1S/C11H14N2/c1-3-9-10(12-6-1)5-8-13-7-2-4-11(9)13/h1,3,6,11H,2,4-5,7-8H2 |
| InChIKey | ZMJTXIGSURTHEB-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.95°C at 760 mmHg (Cal.) |
| Flash point | 121.295°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,10B-Hexahydropyrido(2,3-g)Indolizine |
