|
CAS#: 65783-10-0 Product: 1-(3,4-Dichlorophenyl)guanidine No suppilers available for the product. |
| Classification | Chemical reagent >> Organic reagent >> Guanidine salt |
|---|---|
| Name | 1-(3,4-Dichlorophenyl)guanidine |
| Synonyms | N-(3,4-Dichlorophenyl)guanidine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7Cl2N3 |
| Molecular Weight | 204.06 |
| CAS Registry Number | 65783-10-0 |
| SMILES | C1=CC(=C(C=C1NC(=N)N)Cl)Cl |
| InChI | 1S/C7H7Cl2N3/c8-5-2-1-4(3-6(5)9)12-7(10)11/h1-3H,(H4,10,11,12) |
| InChIKey | NNRSVGLUJAPMQD-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.1±50.0°C at 760 mmHg (Cal.) |
| Flash point | 132.9±30.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4-Dichlorophenyl)guanidine |