Online Database of Chemicals from Around the World
|
CAS#: 6588-16-5 Product: (p-Tolyl)Thiophosphonoyl Dichloride No suppilers available for the product. |
| Name | (p-Tolyl)Thiophosphonoyl Dichloride |
|---|---|
| Synonyms | Dichloro-(4-Methylphenyl)-Thioxo-Phosphorane; Dichloro-(4-Methylphenyl)-Thioxophosphorane; Dichloro-(4-Methylphenyl)-Sulfanylidene-Phosphorane |
| Molecular Structure |  |
| Molecular Formula | C7H7Cl2PS |
| Molecular Weight | 225.07 |
| CAS Registry Number | 6588-16-5 |
| EINECS | 229-519-2 |
| SMILES | C1=CC(=CC=C1C)[P](=S)(Cl)Cl |
| InChI | 1S/C7H7Cl2PS/c1-6-2-4-7(5-3-6)10(8,9)11/h2-5H,1H3 |
| InChIKey | SHHXFAQJKCJMOT-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.842°C at 760 mmHg (Cal.) |
| Flash point | 126.673°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (p-Tolyl)Thiophosphonoyl Dichloride |