Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2S)-2-Amino-N-ethylcyclopentanecarboxamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 |
| CAS Registry Number | 659734-46-0 |
| SMILES | CCNC(=O)[C@@H]1CCC[C@@H]1N |
| InChI | 1S/C8H16N2O/c1-2-10-8(11)6-4-3-5-7(6)9/h6-7H,2-5,9H2,1H3,(H,10,11)/t6-,7+/m1/s1 |
| InChIKey | HFJAGCZBHSLSCK-RQJHMYQMSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.8±31.0°C at 760 mmHg (Cal.) |
| Flash point | 152.0±24.8°C (Cal.) |
| Refractive index | 1.488 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-Amino-N-ethylcyclopentanecarboxamide |