| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.fine-chemtech.com | |||
![]() | +86 (25) 5207-8417 +86 17714198479 | |||
![]() | +86 (25) 5207-8417 | |||
![]() | sales@fine-chemtech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink Standard supplier since 2007 | ||||
| Name | 2,6-Dicyclopentylphenol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 |
| CAS Registry Number | 66003-79-0 |
| EC Number | 266-052-3 |
| SMILES | C1CCC(C1)C2=C(C(=CC=C2)C3CCCC3)O |
| Solubility | 3.334 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.572, Calc.* |
| Melting point | 108.43 °C |
| Boiling Point | 345.57 °C, 268.6±9.0 °C (760 mmHg), Calc.* |
| Flash Point | 122.8±7.2 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,6-Dicyclopentylphenol |