Online Database of Chemicals from Around the World
|
CAS#: 66170-00-1 Product: (2S)-4-Amino-2-{[(2S)-2-ammonio-3-methylbutanoyl]amino}-4-oxobutanoate No suppilers available for the product. |
| Name | (2S)-4-Amino-2-{[(2S)-2-ammonio-3-methylbutanoyl]amino}-4-oxobutanoate |
|---|---|
| Synonyms | L-Val-L-Asn; L-valyl-L-asparagine; val-asn |
| Molecular Structure | ![CAS#: 66170-00-1， (2S)-4-Amino-2-{[(2S)-2-ammonio-3-methylbutanoyl]amino}-4-oxobutanoate](/moreStructures/66170-00-1.gif) |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 |
| CAS Registry Number | 66170-00-1 |
| SMILES | [O-]C(=O)[C@@H](NC(=O)[C@@H]([NH3+])C(C)C)CC(=O)N |
| InChI | 1S/C9H17N3O4/c1-4(2)7(11)8(14)12-5(9(15)16)3-6(10)13/h4-5,7H,3,11H2,1-2H3,(H2,10,13)(H,12,14)(H,15,16)/t5-,7-/m0/s1 |
| InChIKey | WITCOKQIPFWQQD-FSPLSTOPSA-N |
| Density | 1.261g/cm3 (Cal.) |
|---|---|
| Boiling point | 568.791°C at 760 mmHg (Cal.) |
| Flash point | 297.794°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-4-Amino-2-{[(2S)-2-ammonio-3-methylbutanoyl]amino}-4-oxobutanoate |