|
CAS#: 66194-68-1 Product: Methanesulfonic Acid, (1R)-1-Methylpropyl Ester No suppilers available for the product. |
| Name | Methanesulfonic Acid, (1R)-1-Methylpropyl Ester |
|---|---|
| Synonyms | (R)-2-Butyl Methanesulfonate; (R)-2-Butylmethanesulfonate; (R)-Isobutyl Methanesulfonate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H12O3S |
| Molecular Weight | 152.21 |
| CAS Registry Number | 66194-68-1 |
| SMILES | [C@H](O[S](C)(=O)=O)(CC)C |
| InChI | 1S/C5H12O3S/c1-4-5(2)8-9(3,6)7/h5H,4H2,1-3H3/t5-/m1/s1 |
| InChIKey | BQWQGEBNCNNFCI-RXMQYKEDSA-N |
| Density | 1.096g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.773°C at 760 mmHg (Cal.) |
| Flash point | 96.997°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methanesulfonic Acid, (1R)-1-Methylpropyl Ester |