Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Hydroxy-2-nitrophenyl acetate |
|---|---|
| Synonyms | 3-hydroxy-2-nitrophenyl acetate; 3-Hydroxy-2-nitrophenyl acetate # |
| Molecular Structure |  |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.14 |
| CAS Registry Number | 662138-32-1 |
| SMILES | O=C(Oc1cccc(O)c1[N+]([O-])=O)C |
| InChI | 1S/C8H7NO5/c1-5(10)14-7-4-2-3-6(11)8(7)9(12)13/h2-4,11H,1H3 |
| InChIKey | WMKLXCRTRGYMOB-UHFFFAOYSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.082°C at 760 mmHg (Cal.) |
| Flash point | 144.962°C (Cal.) |
| Refractive index | 1.585 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-2-nitrophenyl acetate |