Online Database of Chemicals from Around the World
|
CAS#: 6628-98-4 Product: 4,5-Dihydropyrene No suppilers available for the product. |
| Name | 4,5-Dihydropyrene |
|---|---|
| Synonyms | 4-05-00-02418 (Beilstein Handbook Reference); Brn 1868443; Nsc 59790 |
| Molecular Structure |  |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 6628-98-4 |
| SMILES | C1=CC=C4C2=C1CCC3=CC=CC(=C23)C=C4 |
| InChI | 1S/C16H12/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-7,9H,8,10H2 |
| InChIKey | WPCIUCNVWJNRCD-UHFFFAOYSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.368°C at 760 mmHg (Cal.) |
| Flash point | 175.623°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dihydropyrene |