Online Database of Chemicals from Around the World
|
CAS#: 6631-12-5 Product: [4-(4-Methoxyphenyl)-4,5-Dihydro-3H-Pyrazol-3-Yl]-Phenyl-Methanone No suppilers available for the product. |
| Name | [4-(4-Methoxyphenyl)-4,5-Dihydro-3H-Pyrazol-3-Yl]-Phenyl-Methanone |
|---|---|
| Synonyms | [4-(4-Methoxyphenyl)-4,5-Dihydro-3H-Pyrazol-3-Yl]-Phenyl-Methanone; Mls000737311; Smr000528260 |
| Molecular Structure | ![CAS#: 6631-12-5， [4-(4-Methoxyphenyl)-4,5-Dihydro-3H-Pyrazol-3-Yl]-Phenyl-Methanone](/moreStructures/6631-12-5.gif) |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 |
| CAS Registry Number | 6631-12-5 |
| SMILES | C3=CC=C(C(=O)C1N=NCC1C2=CC=C(C=C2)OC)C=C3 |
| InChI | 1S/C17H16N2O2/c1-21-14-9-7-12(8-10-14)15-11-18-19-16(15)17(20)13-5-3-2-4-6-13/h2-10,15-16H,11H2,1H3 |
| InChIKey | UMLPMFSGVFWLJO-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.857°C at 760 mmHg (Cal.) |
| Flash point | 189.08°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(4-Methoxyphenyl)-4,5-Dihydro-3H-Pyrazol-3-Yl]-Phenyl-Methanone |