Online Database of Chemicals from Around the World
| Leap Chem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (852) 3060-6658 | |||
 |
market19@leapchem.com | |||
 |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | 2-Bromo-7-Nitrofluorene |
|---|---|
| Synonyms | Nsc 48266; Nsc48266; 2-Bromo-7-Nitrofluorene |
| Molecular Structure |  |
| Molecular Formula | C13H8BrNO2 |
| Molecular Weight | 290.12 |
| CAS Registry Number | 6638-61-5 |
| SMILES | C3=C2C1=C(C=C(Br)C=C1)CC2=CC(=C3)[N+](=O)[O-] |
| InChI | 1S/C13H8BrNO2/c14-10-1-3-12-8(6-10)5-9-7-11(15(16)17)2-4-13(9)12/h1-4,6-7H,5H2 |
| InChIKey | QTQRHYLAOSURLC-UHFFFAOYSA-N |
| Density | 1.645g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.559°C at 760 mmHg (Cal.) |
| Flash point | 211.775°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-7-Nitrofluorene |