Online Database of Chemicals from Around the World
| Name | 1,1,2,2,3,3,4,4-Octafluoro-5-(Vinyloxy)Pentane |
|---|---|
| Synonyms | 5-Ethenoxy-1,1,2,2,3,3,4,4-Octafluoro-Pentane; 2,2,3,3,4,4,5,5-Octafluoropentoxyethylene; 1,1,2,2,3,3,4,4-Octafluoro-5-(Vinyloxy)Pentane |
| Molecular Structure |  |
| Molecular Formula | C7H6F8O |
| Molecular Weight | 258.11 |
| CAS Registry Number | 66396-73-4 |
| EINECS | 266-339-3 |
| SMILES | C(OC=C)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | 1S/C7H6F8O/c1-2-16-3-5(10,11)7(14,15)6(12,13)4(8)9/h2,4H,1,3H2 |
| InChIKey | LIXQMBUPLJAAOE-UHFFFAOYSA-N |
| Density | 1.361g/cm3 (Cal.) |
|---|---|
| Boiling point | 131.252°C at 760 mmHg (Cal.) |
| Flash point | 38.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4-Octafluoro-5-(Vinyloxy)Pentane |
