Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1S,3S)-1,2,3-Cyclooctanetriol |
|---|---|
| Synonyms | (1S,3S)-cyclooctane-1,2,3-triol; 1,2,3-Cyclooctanetriol, (1S,3S)- |
| Molecular Structure |  |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 |
| CAS Registry Number | 664987-27-3 |
| SMILES | C1CC[C@@H](C([C@H](CC1)O)O)O |
| InChI | 1S/C8H16O3/c9-6-4-2-1-3-5-7(10)8(6)11/h6-11H,1-5H2/t6-,7-/m0/s1 |
| InChIKey | JABDUNXUMGVHJU-BQBZGAKWSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.758°C at 760 mmHg (Cal.) |
| Flash point | 123.571°C (Cal.) |
| Refractive index | 1.54 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,3S)-1,2,3-Cyclooctanetriol |