Online Database of Chemicals from Around the World
| Name | Bis(3,3,3-Trifluoropropyl)Dichlorosilane |
|---|---|
| Synonyms | Bis(Trifluoropropyl)Dichlorosilane; Dichlorobis(3,3,3-Trifluoropropyl)Silane |
| Molecular Structure |  |
| Molecular Formula | C6H8Cl2F6Si |
| Molecular Weight | 293.11 |
| CAS Registry Number | 665-98-5 |
| EINECS | 211-561-8 |
| SMILES | C([Si](CCC(F)(F)F)(Cl)Cl)CC(F)(F)F |
| InChI | 1S/C6H8Cl2F6Si/c7-15(8,3-1-5(9,10)11)4-2-6(12,13)14/h1-4H2 |
| InChIKey | RUWVYOFYCWPDMF-UHFFFAOYSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 152.287°C at 760 mmHg (Cal.) |
| Flash point | 45.902°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(3,3,3-Trifluoropropyl)Dichlorosilane |
