Online Database of Chemicals from Around the World
|
CAS#: 66640-60-6 Product: 3-Methylsulfonyl-2,2',4',5,5'-Pentachlorobiphenyl No suppilers available for the product. |
| Name | 3-Methylsulfonyl-2,2',4',5,5'-Pentachlorobiphenyl |
|---|---|
| Synonyms | 2,5-Dichloro-1-Mesyl-3-(2,4,5-Trichlorophenyl)Benzene; 1,1'-Biphenyl, 2,2',4',5,5'-Pentachloro-3-(Methylsulfonyl)-; 2,2',4',5,5',-Pentachloro-3-(Methylsulfonyl)-1,1'-Biphenyl |
| Molecular Structure |  |
| Molecular Formula | C13H7Cl5O2S |
| Molecular Weight | 404.52 |
| CAS Registry Number | 66640-60-6 |
| SMILES | C1=C(Cl)C(=CC(=C1Cl)C2=C(Cl)C(=CC(=C2)Cl)[S](=O)(=O)C)Cl |
| InChI | 1S/C13H7Cl5O2S/c1-21(19,20)12-3-6(14)2-8(13(12)18)7-4-10(16)11(17)5-9(7)15/h2-5H,1H3 |
| InChIKey | PYZHICPTPGJNJA-UHFFFAOYSA-N |
| Density | 1.579g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.238°C at 760 mmHg (Cal.) |
| Flash point | 272.664°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylsulfonyl-2,2',4',5,5'-Pentachlorobiphenyl |