| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 1,2,3,4,5-Pentafluoro-6-(2,2,2-Trifluoroethoxy)Benzene |
|---|---|
| Synonyms | (2,2,2-Trifluoroethoxy)pentafluorobenzene; 2,3,4,5,6-pentafluoro-1-(2,2,2-trifluoroethoxy)benzene; Pentafluoro(2,2,2-trifluoroethoxy)benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H2F8O |
| Molecular Weight | 266.09 |
| CAS Registry Number | 6669-03-0 |
| SMILES | FC(F)(F)COc1c(F)c(F)c(F)c(F)c1F |
| InChI | 1S/C8H2F8O/c9-2-3(10)5(12)7(6(13)4(2)11)17-1-8(14,15)16/h1H2 |
| InChIKey | MCVAIMHKNJBNTQ-UHFFFAOYSA-N |
| Density | 1.59g/cm3 (Cal.) |
|---|---|
| Boiling point | 146-147°C (Expl.) |
| 151.477°C at 760 mmHg (Cal.) | |
| Flash point | 51.392°C (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| Irritant | |
| R36/37/38 | |
| S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5-Pentafluoro-6-(2,2,2-Trifluoroethoxy)Benzene |