Online Database of Chemicals from Around the World
| Name | 4,5,7-Trimethylindan |
|---|---|
| Synonyms | 4,5,7-Trimethylindane; Indan, 4,5,7-Trimethyl-; 4,5,7-Trimethylindan |
| Molecular Structure |  |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 |
| CAS Registry Number | 6682-06-0 |
| SMILES | C1=C(C)C2=C(C(=C1C)C)CCC2 |
| InChI | 1S/C12H16/c1-8-7-9(2)11-5-4-6-12(11)10(8)3/h7H,4-6H2,1-3H3 |
| InChIKey | NFLKDIOSDXSKTG-UHFFFAOYSA-N |
| Density | 0.958g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.983°C at 760 mmHg (Cal.) |
| Flash point | 99.261°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,7-Trimethylindan |
