Online Database of Chemicals from Around the World
|
CAS#: 66903-21-7 Product: 3,5-Dinitro-2-phenylphenol No suppilers available for the product. |
| Name | 3,5-Dinitro-2-phenylphenol |
|---|---|
| Synonyms | 3,5-Dinitro-2-Phenyl-Phenol; 2-Biphenylol, 4,6-Dinitro-; Dinitro-4,6 O-Oxydiphenyl [French] |
| Molecular Structure |  |
| Molecular Formula | C12H8N2O5 |
| Molecular Weight | 260.21 |
| CAS Registry Number | 66903-21-7 |
| SMILES | C1=C([N+]([O-])=O)C(=C(O)C=C1[N+]([O-])=O)C2=CC=CC=C2 |
| InChI | 1S/C12H8N2O5/c15-11-7-9(13(16)17)6-10(14(18)19)12(11)8-4-2-1-3-5-8/h1-7,15H |
| InChIKey | OSOFRXFHWWCPBD-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.402°C at 760 mmHg (Cal.) |
| Flash point | 171.794°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dinitro-2-phenylphenol |