Online Database of Chemicals from Around the World
|
CAS#: 67010-78-0 Product: 6 alpha-Hydroxy(Allo)Tetrahydrocortisol No suppilers available for the product. |
| Name | 6 alpha-Hydroxy(Allo)Tetrahydrocortisol |
|---|---|
| Synonyms | 3,6,11,17,21-Pentahydroxypregnan-20-One; 6Ahathcl; 6Alpha-Hydroxy(Allo)Tetrahydrocortisol |
| Molecular Structure |  |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 |
| CAS Registry Number | 67010-78-0 |
| SMILES | [C@H]1(CC[C@]3([C@H](C1)[C@H](C[C@H]4[C@@H]2CC[C@](C(CO)=O)([C@@]2(C)C[C@@H]([C@H]34)O)O)O)C)O |
| InChI | 1S/C21H34O6/c1-19-5-3-11(23)7-14(19)15(24)8-12-13-4-6-21(27,17(26)10-22)20(13,2)9-16(25)18(12)19/h11-16,18,22-25,27H,3-10H2,1-2H3/t11-,12+,13+,14-,15+,16+,18-,19+,20+,21+/m1/s1 |
| InChIKey | YZEJGGKLJNZFGY-QZJGIPCSSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 585.969°C at 760 mmHg (Cal.) |
| Flash point | 322.22°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6 alpha-Hydroxy(Allo)Tetrahydrocortisol |