| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Chem Service, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | N-Desethyl-Pirimiphos-Methyl |
| Synonyms | 4-Dimethoxyphosphinothioyloxy-N-Ethyl-6-Methyl-Pyrimidin-2-Amine; 4-Dimethoxyphosphinothioyloxy-N-Ethyl-6-Methyl-2-Pyrimidinamine; (4-Dimethoxythiophosphoryloxy-6-Methyl-Pyrimidin-2-Yl)-Ethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16N3O3PS |
| Molecular Weight | 277.28 |
| CAS Registry Number | 67018-59-1 |
| SMILES | C1=C(N=C(N=C1O[P](=S)(OC)OC)NCC)C |
| InChI | 1S/C9H16N3O3PS/c1-5-10-9-11-7(2)6-8(12-9)15-16(17,13-3)14-4/h6H,5H2,1-4H3,(H,10,11,12) |
| InChIKey | FMJYNECHJIZSCE-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.494°C at 760 mmHg (Cal.) |
| Flash point | 180.288°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Desethyl-Pirimiphos-Methyl |