Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-4-Pyridinyl-N'-(1,2,2-Trimethylpropyl)-Thiourea |
|---|---|
| Synonyms | 3-(4-Pyridyl)-1-(1,2,2-Trimethylpropyl)Thiourea; 1-(3,3-Dimethylbutan-2-Yl)-3-Pyridin-4-Yl-Thiourea |
| Molecular Structure |  |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.36 |
| CAS Registry Number | 67027-06-9 |
| EINECS | 266-553-7 |
| SMILES | C1=NC=CC(=C1)NC(=S)NC(C(C)(C)C)C |
| InChI | 1S/C12H19N3S/c1-9(12(2,3)4)14-11(16)15-10-5-7-13-8-6-10/h5-9H,1-4H3,(H2,13,14,15,16) |
| InChIKey | TYNORQRGVYNOSO-UHFFFAOYSA-N |
| Density | 1.102g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.62°C at 760 mmHg (Cal.) |
| Flash point | 154.359°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-4-Pyridinyl-N'-(1,2,2-Trimethylpropyl)-Thiourea |