Online Database of Chemicals from Around the World
|
CAS#: 67031-82-7 Product: 1-(3-Pyridyl)Ethyl Benzoate No suppilers available for the product. |
| Name | 1-(3-Pyridyl)Ethyl Benzoate |
|---|---|
| Synonyms | 1-(3-Pyridyl)Ethyl Benzoate; Benzoic Acid 1-(3-Pyridyl)Ethyl Ester; 4-21-00-00520 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 67031-82-7 |
| SMILES | C2=C(C(OC(C1=CC=CC=C1)=O)C)C=NC=C2 |
| InChI | 1S/C14H13NO2/c1-11(13-8-5-9-15-10-13)17-14(16)12-6-3-2-4-7-12/h2-11H,1H3 |
| InChIKey | PLSNYBSMHHRQBN-UHFFFAOYSA-N |
| Density | 1.145g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.038°C at 760 mmHg (Cal.) |
| Flash point | 169.731°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Pyridyl)Ethyl Benzoate |