|
CAS#: 67036-33-3 Product: Chloroac-Asp-OH No suppilers available for the product. |
| Name | Chloroac-Asp-OH |
|---|---|
| Synonyms | 2-[(2-Chloro-1-Oxoethyl)Amino]Butanedioic Acid; 2-[(2-Chloroacetyl)Amino]Succinic Acid; 2-(2-Chloroethanoylamino)Butanedioic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8ClNO5 |
| Molecular Weight | 209.59 |
| CAS Registry Number | 67036-33-3 |
| SMILES | C(C(NC(CCl)=O)C(O)=O)C(O)=O |
| InChI | 1S/C6H8ClNO5/c7-2-4(9)8-3(6(12)13)1-5(10)11/h3H,1-2H2,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | COXKWXFZCRVVQB-UHFFFAOYSA-N |
| Density | 1.558g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.64°C at 760 mmHg (Cal.) |
| Flash point | 228.758°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloroac-Asp-OH |