Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3,3'-Dimethoxybenzoin |
|---|---|
| Synonyms | Nsc26662; M-Anisoin |
| Molecular Structure |  |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 |
| CAS Registry Number | 6706-95-2 |
| SMILES | C1=CC=C(C=C1OC)C(O)C(=O)C2=CC(=CC=C2)OC |
| InChI | 1S/C16H16O4/c1-19-13-7-3-5-11(9-13)15(17)16(18)12-6-4-8-14(10-12)20-2/h3-10,15,17H,1-2H3 |
| InChIKey | CZOPVKGENSIFOT-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.649°C at 760 mmHg (Cal.) |
| Flash point | 158.954°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Dimethoxybenzoin |