| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Vildagliptin Dipyrrolidine Impurity |
|---|---|
| Synonyms | Cyclo(Pro-Pro);1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 |
| CAS Registry Number | 6708-06-1 |
| SMILES | C1CC2C(=O)N3CCCC3C(=O)N2C1 |
| Solubility | 1.135e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.602, Calc.* |
| Melting point | 142.86 °C |
| Boiling Point | 373.93 °C, 413.5±25.0 °C (760 mmHg), Calc.* |
| Flash Point | 207.9±15.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Vildagliptin Dipyrrolidine Impurity |