Online Database of Chemicals from Around the World
| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (203) 786-5290 | |||
 |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2,6,8-Tetrachlorodibenzo-p-Dioxin |
|---|---|
| Synonyms | 1,2,6,8-Tetrachloro Dibenzo-P-Dioxin; Dibenzo-P-Dioxin, 1,2,6,8-Tetrachloro; 1,2,6,8-Tetrachlorodibenzo-P-Dioxin |
| Molecular Structure |  |
| Molecular Formula | C12H4Cl4O2 |
| Molecular Weight | 321.97 |
| CAS Registry Number | 67323-56-2 |
| SMILES | C1=C(C3=C(C=C1Cl)OC2=C(C(=CC=C2O3)Cl)Cl)Cl |
| InChI | 1S/C12H4Cl4O2/c13-5-3-7(15)11-9(4-5)18-12-8(17-11)2-1-6(14)10(12)16/h1-4H |
| InChIKey | YYUFYZDSYHKVDP-UHFFFAOYSA-N |
| Density | 1.643g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.253°C at 760 mmHg (Cal.) |
| Flash point | 162.858°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,6,8-Tetrachlorodibenzo-p-Dioxin |