Online Database of Chemicals from Around the World
|
CAS#: 67364-59-4 Product: 10-Phenyl-15,16-Dioxa-3-Thia-10-Azatricyclo[10.2.1.15,8]Hexadeca-5,7,12,14(1)-Tetrene-9,11-Dione No suppilers available for the product. |
| Name | 10-Phenyl-15,16-Dioxa-3-Thia-10-Azatricyclo[10.2.1.15,8]Hexadeca-5,7,12,14(1)-Tetrene-9,11-Dione |
|---|---|
| Molecular Structure | ![CAS#: 67364-59-4， 10-Phenyl-15,16-Dioxa-3-Thia-10-Azatricyclo[10.2.1.15,8]Hexadeca-5,7,12,14(1)-Tetrene-9,11-Dione](/moreStructures/67364-59-4.gif) |
| Molecular Formula | C18H13NO4S |
| Molecular Weight | 339.37 |
| CAS Registry Number | 67364-59-4 |
| SMILES | S3CC1=CC=C(O1)C(=O)N(C(=O)C2=CC=C(O2)C3)C4=CC=CC=C4 |
| InChI | 1S/C18H13NO4S/c20-17-15-8-6-13(22-15)10-24-11-14-7-9-16(23-14)18(21)19(17)12-4-2-1-3-5-12/h1-9H,10-11H2 |
| InChIKey | JGESNVGHKURAJO-UHFFFAOYSA-N |
| Density | 1.356g/cm3 (Cal.) |
|---|---|
| Boiling point | 567.2°C at 760 mmHg (Cal.) |
| Flash point | 296.832°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Phenyl-15,16-Dioxa-3-Thia-10-Azatricyclo[10.2.1.15,8]Hexadeca-5,7,12,14(1)-Tetrene-9,11-Dione |