Online Database of Chemicals from Around the World
|
CAS#: 67412-31-1 Product: Pyrimethamine 3-N-oxide No suppilers available for the product. |
| Name | Pyrimethamine 3-N-oxide |
|---|---|
| Synonyms | 5-[(4-Chlorophenyl)Methyl]-6-Ethyl-3-Hydroxy-2-Imino-Pyrimidin-4-Amine; 5-[(4-Chlorophenyl)Methyl]-6-Ethyl-3-Hydroxy-2-Imino-4-Pyrimidinamine; [5-(4-Chlorobenzyl)-6-Ethyl-3-Hydroxy-2-Imino-Pyrimidin-4-Yl]Amine |
| Molecular Structure |  |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 |
| CAS Registry Number | 67412-31-1 |
| SMILES | C2=C(CC1=C(N(O)C(N=C1CC)=N)N)C=CC(=C2)Cl |
| InChI | 1S/C13H15ClN4O/c1-2-11-10(12(15)18(19)13(16)17-11)7-8-3-5-9(14)6-4-8/h3-6,16,19H,2,7,15H2,1H3 |
| InChIKey | ZWCGQUMUTNISIG-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.007°C at 760 mmHg (Cal.) |
| Flash point | 214.465°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyrimethamine 3-N-oxide |