Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Hydrazinoquinoxaline 1-oxide |
|---|---|
| Synonyms | (E)-3-hydrazono-3,4-dihydroquinoxaline 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 |
| CAS Registry Number | 67452-62-4 |
| SMILES | c1ccc2c(c1)[nH]/c(=N\N)/c[n+]2[O-] |
| InChI | 1S/C8H8N4O/c9-11-8-5-12(13)7-4-2-1-3-6(7)10-8/h1-5H,9H2,(H,10,11) |
| InChIKey | WFOFZCHUWQJDFG-UHFFFAOYSA-N |
| Density | 1.486g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.081°C at 760 mmHg (Cal.) |
| Flash point | 207.858°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydrazinoquinoxaline 1-oxide |