|
CAS#: 6750-59-0 Product: Soyasapogenol E No suppilers available for the product. |
| Name | Soyasapogenol E |
|---|---|
| Synonyms | (4Ar,6Ar,6As,6Br,9S,10S,12Ar,14Br)-10-Hydroxy-2,2,4A,6A,6B,9,12A-Heptamethyl-9-Methylol-3,5,6,6A,7,8,8A,10,11,12,13,14B-Dodecahydro-1H-Picen-4-One; Olean-12-En-22-One, 3,23-Dihydroxy-, (3Beta,4Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 |
| CAS Registry Number | 6750-59-0 |
| SMILES | [C@@]23([C@@H]([C@@]1(C([C@]([C@@H](O)CC1)(CO)C)CC2)C)CC=C4[C@]3(CC[C@@]5([C@@H]4CC(CC5=O)(C)C)C)C)C |
| InChI | 1S/C30H48O3/c1-25(2)16-20-19-8-9-22-27(4)12-11-23(32)28(5,18-31)21(27)10-13-30(22,7)29(19,6)15-14-26(20,3)24(33)17-25/h8,20-23,31-32H,9-18H2,1-7H3/t20-,21?,22-,23+,26-,27+,28-,29-,30-/m1/s1 |
| InChIKey | FNRBOAGVUNHDIL-DSXFTMRLSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.595°C at 760 mmHg (Cal.) |
| Flash point | 303.267°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Soyasapogenol E |