Online Database of Chemicals from Around the World
|
CAS#: 67511-31-3 Product: 4,6,6-Trimethylhept-3-En-2-One No suppilers available for the product. |
| Name | 4,6,6-Trimethylhept-3-En-2-One |
|---|---|
| Synonyms | 3-Hepten-2-One, 4,6,6-Trimethyl-; 4,6,6-Trimethylhept-3-En-2-One; Ai3-16355 |
| Molecular Structure |  |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 67511-31-3 |
| EINECS | 266-707-3 |
| SMILES | C(C(C)(C)C)\C(=C\C(=O)C)C |
| InChI | 1S/C10H18O/c1-8(6-9(2)11)7-10(3,4)5/h6H,7H2,1-5H3/b8-6+ |
| InChIKey | YQNTTZALAZYHKN-SOFGYWHQSA-N |
| Density | 0.837g/cm3 (Cal.) |
|---|---|
| Boiling point | 209.785°C at 760 mmHg (Cal.) |
| Flash point | 78.459°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6,6-Trimethylhept-3-En-2-One |