Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3aR,8aS)-Decahydro-2-azulenol |
|---|---|
| Synonyms | (3aR,8aS)-decahydroazulen-2-ol |
| Molecular Structure |  |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 675837-28-2 |
| SMILES | C1CC[C@@H]2CC(C[C@@H]2CC1)O |
| InChI | 1S/C10H18O/c11-10-6-8-4-2-1-3-5-9(8)7-10/h8-11H,1-7H2/t8-,9+,10? |
| InChIKey | HDGFYCWYJLZXGR-ULKQDVFKSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.0±8.0°C at 760 mmHg (Cal.) |
| Flash point | 102.1±10.9°C (Cal.) |
| Refractive index | 1.501 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3aR,8aS)-Decahydro-2-azulenol |