Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Amino-1,3-benzothiazol-6-yl acetate |
|---|---|
| Synonyms | 2-aminobenzo[d]thiazol-6-yl acetate |
| Molecular Structure |  |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 |
| CAS Registry Number | 67617-81-6 |
| SMILES | CC(=O)Oc1ccc2c(c1)sc(n2)N |
| InChI | 1S/C9H8N2O2S/c1-5(12)13-6-2-3-7-8(4-6)14-9(10)11-7/h2-4H,1H3,(H2,10,11) |
| InChIKey | RHCZQCDOCWILNB-UHFFFAOYSA-N |
| Density | 1.425g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.663°C at 760 mmHg (Cal.) |
| Flash point | 187.042°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-1,3-benzothiazol-6-yl acetate |