Online Database of Chemicals from Around the World
|
CAS#: 67624-96-8 Product: 2-Diethylamino-N-(2-Chloro-6-Methylphenyl)Propionamide No suppilers available for the product. |
| Name | 2-Diethylamino-N-(2-Chloro-6-Methylphenyl)Propionamide |
|---|---|
| Synonyms | N-(2-Chloro-6-Methyl-Phenyl)-2-Diethylamino-Propanamide; N-(2-Chloro-6-Methyl-Phenyl)-2-Diethylamino-Propionamide; Brn 2738812 |
| Molecular Structure |  |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 |
| CAS Registry Number | 67624-96-8 |
| SMILES | C1=C(C(=C(C=C1)Cl)NC(C(N(CC)CC)C)=O)C |
| InChI | 1S/C14H21ClN2O/c1-5-17(6-2)11(4)14(18)16-13-10(3)8-7-9-12(13)15/h7-9,11H,5-6H2,1-4H3,(H,16,18) |
| InChIKey | YNAFEFREWILTEW-UHFFFAOYSA-N |
| Density | 1.116g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.857°C at 760 mmHg (Cal.) |
| Flash point | 185.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Diethylamino-N-(2-Chloro-6-Methylphenyl)Propionamide |