Online Database of Chemicals from Around the World
|
CAS#: 67632-66-0 Product: Trichloromethyl perchlorate No suppilers available for the product. |
| Name | Trichloromethyl perchlorate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | CCl4O4 |
| Molecular Weight | 217.82 |
| CAS Registry Number | 67632-66-0 |
| SMILES | C(OCl(=O)(=O)=O)(Cl)(Cl)Cl |
| InChI | 1S/CCl4O4/c2-1(3,4)9-5(6,7)8 |
| InChIKey | JWQHSOBOERYWHT-UHFFFAOYSA-N |
| Boiling point | 133.972°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 34.825°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloromethyl perchlorate |