Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Simagchem Corporation | China | Inquire | ||
|---|---|---|---|---|
|
+86 13806087780 | |||
|
sale@simagchem.com | |||
| Chemical manufacturer since 2002 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | Floralozone |
|---|---|
| Synonyms | 3-(2-Ethylphenyl)-2,2-Dimethyl-Propanal; 3-(2-Ethylphenyl)-2,2-Dimethyl-Propionaldehyde; 3-(O-Ethylphenyl)-2,2-Dimethylpropionaldehyde |
| Molecular Structure |  |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 67634-14-4 |
| EINECS | 266-818-7 |
| SMILES | C1=C(C(=CC=C1)CC(C=O)(C)C)CC |
| InChI | 1S/C13H18O/c1-4-11-7-5-6-8-12(11)9-13(2,3)10-14/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | ITJHALDCYCTNNJ-UHFFFAOYSA-N |
| Density | 0.942g/cm3 (Cal.) |
|---|---|
| Boiling point | 262.068°C at 760 mmHg (Cal.) |
| Flash point | 113.147°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Floralozone |