| Shanghai Rui Yun Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.rychemical.com.cn | |||
![]() | +86 (21) 6726-7633 | |||
![]() | +86 (21) 6726-7655 | |||
![]() | sales@rychemical.com.cn | |||
![]() | WeChat: 13917251563 | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Premium supplier since 2009 | ||||
| Classification | Organic raw materials >> Organic fluorine compound |
|---|---|
| Name | Difluoro(fluorosulfonyl)acetyl fluoride |
| Molecular Structure | ![]() |
| Molecular Formula | C2F4O3S |
| Molecular Weight | 180.08 |
| CAS Registry Number | 677-67-8 |
| EC Number | 211-642-8 |
| SMILES | C(=O)(C(F)(F)S(=O)(=O)F)F |
| Solubility | 4.587 mg/L (25 °C water) |
|---|---|
| Density | 1.8±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.330, Calc.* |
| Melting point | 15.82 °C |
| Boiling Point | 173.74 °C, 102.3±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 15.7±27.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H335 Details | ||||||||||||||||||||||||||||
| Safety Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details | ||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||
|
Difluoro(fluorosulfonyl)acetyl fluoride, with the chemical formula C3F4O3S, is a fluorinated compound that features both difluoroacetyl and fluorosulfonyl groups. This compound is notable for its distinctive chemical properties, which make it valuable in various industrial and research applications. The discovery of difluoro(fluorosulfonyl)acetyl fluoride is rooted in the broader study of fluorinated organic compounds, which gained prominence in the mid-20th century. Researchers in fluorine chemistry explored a range of fluorinated acids and esters to understand their reactivity and potential uses. The synthesis of difluoro(fluorosulfonyl)acetyl fluoride involves the reaction of difluoroacetyl fluoride with fluorosulfonyl chloride. This reaction is carried out under controlled conditions to produce the desired compound, which is characterized by the presence of both difluoroacetyl and fluorosulfonyl groups. One of the primary applications of difluoro(fluorosulfonyl)acetyl fluoride is as a reagent in organic synthesis. Its unique structure allows it to serve as a source of both difluoroacetyl and fluorosulfonyl groups, which can be introduced into various organic molecules. This reactivity is particularly useful in the synthesis of complex fluorinated compounds, including pharmaceuticals and agrochemicals. The difluoroacetyl group imparts stability and resistance to chemical degradation, while the fluorosulfonyl group enhances the reactivity of the compound in specific chemical transformations. Difluoro(fluorosulfonyl)acetyl fluoride is also used in the development of fluorinated materials. The incorporation of fluorine and sulfonyl groups into polymer matrices can lead to materials with improved chemical and thermal stability. These materials are valuable in high-performance applications, such as coatings, adhesives, and insulation materials. The compound's ability to impart desirable properties to polymers makes it a useful tool in materials science and engineering. In addition to its applications in synthesis and materials science, difluoro(fluorosulfonyl)acetyl fluoride is employed in research to study the behavior of fluorinated functional groups. Its unique chemical structure provides insight into the reactivity and stability of fluorinated compounds, contributing to the advancement of fluorine chemistry. Researchers use this compound to explore reaction mechanisms and develop new synthetic methodologies. When handling difluoro(fluorosulfonyl)acetyl fluoride, it is essential to follow safety protocols due to its reactive nature. Proper storage and handling procedures should be observed to minimize exposure and ensure safe use. The compound should be handled in well-ventilated areas, and appropriate personal protective equipment should be used to prevent contact with skin and eyes. Overall, difluoro(fluorosulfonyl)acetyl fluoride is a valuable compound in organic synthesis, materials science, and chemical research. Its unique combination of difluoroacetyl and fluorosulfonyl groups provides versatile reactivity and applications in the development of advanced chemical products and materials. References 2014. Improvement of procedures for preparing Tetrafluoroethane-β-sultone and fluorocarbonyldifluoromethanesulfonyl fluoride. Russian Journal of Applied Chemistry, 87(5). DOI: 10.1134/s1070427214050140 2011. Interaction of sulfofluoride group in the organofluorine compounds with silver oxide and carbonate. Russian Journal of General Chemistry, 81(4). DOI: 10.1134/s1070363211040323 1965. Fluorine-containing β-sultones. Communication 12. Difluoro(fluorosulfonyl) acetyl fluoride. Bulletin of the Academy of Sciences of the USSR, Division of chemical science, 14(9). DOI: 10.1007/bf01083800 |
| Market Analysis Reports |
| List of Reports Available for Difluoro(fluorosulfonyl)acetyl fluoride |