Online Database of Chemicals from Around the World
|
CAS#: 6772-77-6 Product: trans-2-(2-(Chlorophenyl)Vinyl)-Pyridine No suppilers available for the product. |
| Name | trans-2-(2-(Chlorophenyl)Vinyl)-Pyridine |
|---|---|
| Synonyms | 2-[(E)-2-(2-Chlorophenyl)Ethenyl]Pyridine; 2-[2-(2-Chlorophenyl)Vinyl]Pyridine; 2-[(E)-2-(2-Chlorophenyl)Vinyl]Pyridine |
| Molecular Structure |  |
| Molecular Formula | C13H10ClN |
| Molecular Weight | 215.68 |
| CAS Registry Number | 6772-77-6 |
| SMILES | C1=C(C(=CC=C1)Cl)\C=C\C2=NC=CC=C2 |
| InChI | 1S/C13H10ClN/c14-13-7-2-1-5-11(13)8-9-12-6-3-4-10-15-12/h1-10H/b9-8+ |
| InChIKey | YEZHQUGOABFELJ-CMDGGOBGSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.805°C at 760 mmHg (Cal.) |
| Flash point | 186.583°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-2-(2-(Chlorophenyl)Vinyl)-Pyridine |