Online Database of Chemicals from Around the World
|
CAS#: 67755-06-0 Product: Thiazinoisoquinolone No suppilers available for the product. |
| Name | Thiazinoisoquinolone |
|---|---|
| Synonyms | 3,4-Dihydro-2H,6H-(1,3)Thiazino(3,2-B)Isoquinolin-6-One; 6-Oxo-3,4-Dihydro-2H,6H-1,3-Thiazino(3,2-B)Isoquinoline; Thiazinoisoquinolone |
| Molecular Structure |  |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 |
| CAS Registry Number | 67755-06-0 |
| SMILES | C1=CC=CC2=C1C(N3C(=C2)SCCC3)=O |
| InChI | 1S/C12H11NOS/c14-12-10-5-2-1-4-9(10)8-11-13(12)6-3-7-15-11/h1-2,4-5,8H,3,6-7H2 |
| InChIKey | LNKBYMKMJSTWOH-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.357°C at 760 mmHg (Cal.) |
| Flash point | 221.33°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiazinoisoquinolone |