Online Database of Chemicals from Around the World
| Name | Dimethyl 9-Oxo-9H-Fluorene-2,6-Dicarboxylate |
|---|---|
| Synonyms | 9-Oxofluorene-2,6-Dicarboxylic Acid Dimethyl Ester; 9-Ketofluorene-2,6-Dicarboxylic Acid Dimethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C17H12O5 |
| Molecular Weight | 296.28 |
| CAS Registry Number | 67801-54-1 |
| EINECS | 267-173-4 |
| SMILES | C1=C(C=C3C(=C1)C2=CC(=CC=C2C3=O)C(=O)OC)C(=O)OC |
| InChI | 1S/C17H12O5/c1-21-16(19)9-4-6-12-13(7-9)11-5-3-10(17(20)22-2)8-14(11)15(12)18/h3-8H,1-2H3 |
| InChIKey | QOPVBVXFXFHNSO-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.694°C at 760 mmHg (Cal.) |
| Flash point | 218.481°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 9-Oxo-9H-Fluorene-2,6-Dicarboxylate |
