Online Database of Chemicals from Around the World
|
CAS#: 67827-57-0 Product: N-(3,5-Dihydroxyphenyl)Benzamide No suppilers available for the product. |
| Name | N-(3,5-Dihydroxyphenyl)Benzamide |
|---|---|
| Synonyms | Benzamide, N-(3,5-Dihydroxyphenyl)-; N-Benzoyl-3,5-Dihydroxyaniline |
| Molecular Structure |  |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 |
| CAS Registry Number | 67827-57-0 |
| EINECS | 267-220-9 |
| SMILES | C1=CC=CC=C1C(NC2=CC(=CC(=C2)O)O)=O |
| InChI | 1S/C13H11NO3/c15-11-6-10(7-12(16)8-11)14-13(17)9-4-2-1-3-5-9/h1-8,15-16H,(H,14,17) |
| InChIKey | DKYHVEQQTGMTQJ-UHFFFAOYSA-N |
| Density | 1.388g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.39°C at 760 mmHg (Cal.) |
| Flash point | 163.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3,5-Dihydroxyphenyl)Benzamide |