|
CAS#: 67828-40-4 Product: 5-Chloro-4-Ethoxy-2-Nitrotoluene No suppilers available for the product. |
| Name | 5-Chloro-4-Ethoxy-2-Nitrotoluene |
|---|---|
| Synonyms | 1-Chloro-2-Ethoxy-5-Methyl-4-Nitro-Benzene; 2-Ethoxy-5-Methyl-4-Nitrochlorobenzene; 5-Chloro-4-Ethoxy-2-Nitrotoluene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 |
| CAS Registry Number | 67828-40-4 |
| EINECS | 267-262-8 |
| SMILES | C1=C(C)C(=CC(=C1Cl)OCC)[N+]([O-])=O |
| InChI | 1S/C9H10ClNO3/c1-3-14-9-5-8(11(12)13)6(2)4-7(9)10/h4-5H,3H2,1-2H3 |
| InChIKey | ZUWXJEWJAWOZRW-UHFFFAOYSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.225°C at 760 mmHg (Cal.) |
| Flash point | 145.048°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-4-Ethoxy-2-Nitrotoluene |