| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | Cyclo(Pro-Trp) |
|---|---|
| Synonyms | 3-(1H-indol-2-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 |
| CAS Registry Number | 67889-75-2 |
| SMILES | C1CC2C(=O)NC(C(=O)N2C1)CC3=CC4=CC=CC=C4N3 |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.690, Calc.* |
| Boiling Point | 633.2±48.0 °C (760 mmHg), Calc.* |
| Flash Point | 336.8±29.6 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Cyclo(Pro-Trp) |