Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Hexahydro-1,1,5,5-Tetramethyl-2H-2,4alpha-Methanonaphthalen-6(5H)-One |
|---|---|
| Synonyms | Hexahydro-1,1,5,5-Tetramethyl-2H-2,4A-Methanonaphthalen-6(5H)-One |
| Molecular Structure |  |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 67952-58-3 |
| EINECS | 267-912-0 |
| SMILES | CC2(C1CC3(CC1)C(C(=O)CCC23)(C)C)C |
| InChI | 1S/C15H24O/c1-13(2)10-7-8-15(9-10)11(13)5-6-12(16)14(15,3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | NILGFRKAXFZEPN-UHFFFAOYSA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.752°C at 760 mmHg (Cal.) |
| Flash point | 119.694°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexahydro-1,1,5,5-Tetramethyl-2H-2,4alpha-Methanonaphthalen-6(5H)-One |