Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 8-Iodo-1-naphthoic anhydride |
|---|---|
| Synonyms | 8-iodo-1-naphthoic anhydride; 8-IODO-1-NAPHTHOICANHYDRIDE |
| Molecular Structure |  |
| Molecular Formula | C22H12I2O3 |
| Molecular Weight | 578.14 |
| CAS Registry Number | 680211-26-1 |
| SMILES | Ic1c2c(ccc1)cccc2C(=O)OC(=O)c3cccc4cccc(I)c34 |
| InChI | 1S/C22H12I2O3/c23-17-11-3-7-13-5-1-9-15(19(13)17)21(25)27-22(26)16-10-2-6-14-8-4-12-18(24)20(14)16/h1-12H |
| InChIKey | ZGPKJQSZWQSYCS-UHFFFAOYSA-N |
| Density | 1.933g/cm3 (Cal.) |
|---|---|
| Boiling point | 648.701°C at 760 mmHg (Cal.) |
| Flash point | 346.122°C (Cal.) |
| Refractive index | 1.772 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Iodo-1-naphthoic anhydride |