Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-(3-Bromophenyl)-5-(2-Naphthalenyl)-1,3,4-Oxadiazole |
|---|---|
| Synonyms | 2-(3-Bromophenyl)-5-(2-Naphthyl)-1,3,4-Oxadiazole; Nsc88163 |
| Molecular Structure |  |
| Molecular Formula | C18H11BrN2O |
| Molecular Weight | 351.20 |
| CAS Registry Number | 68047-41-6 |
| EINECS | 268-292-4 |
| SMILES | C1=C4C(=CC=C1C2=NN=C(O2)C3=CC(=CC=C3)Br)C=CC=C4 |
| InChI | 1S/C18H11BrN2O/c19-16-7-3-6-14(11-16)17-20-21-18(22-17)15-9-8-12-4-1-2-5-13(12)10-15/h1-11H |
| InChIKey | IGQXJSGMCQCEQO-UHFFFAOYSA-N |
| Density | 1.466g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.839°C at 760 mmHg (Cal.) |
| Flash point | 266.979°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(3-Bromophenyl)-5-(2-Naphthalenyl)-1,3,4-Oxadiazole |