Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Oakwood Products, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (800) 467-3386 | |||
|
k_weaver@oakwoodchemical.com | |||
| Chemical manufacturer | ||||
| Name | 5-[(Dimethylcarbamoyl)amino]-2-ethoxybenzenesulfonyl chloride |
|---|---|
| Synonyms | 2-Ethoxy-5-(3,3-dimethylureido)benzene-1-sulfonyl chloride; 5-(3,3-Dimethyl ureido)-2-ethoxy benzenesulfonyl chloride; 5-(3,3-Dimethyl-ureido)-2-ethoxy-benzenesulfonyl |
| Molecular Structure | ![CAS#: 680618-14-8， 5-[(Dimethylcarbamoyl)amino]-2-ethoxybenzenesulfonyl chloride](/moreStructures/680618-14-8.gif) |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 |
| CAS Registry Number | 680618-14-8 |
| SMILES | ClS(=O)(=O)c1cc(ccc1OCC)NC(=O)N(C)C |
| InChI | 1S/C11H15ClN2O4S/c1-4-18-9-6-5-8(13-11(15)14(2)3)7-10(9)19(12,16)17/h5-7H,4H2,1-3H3,(H,13,15) |
| InChIKey | XGEJPGJBEGCJLZ-UHFFFAOYSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.439°C at 760 mmHg (Cal.) |
| Flash point | 256.457°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[(Dimethylcarbamoyl)amino]-2-ethoxybenzenesulfonyl chloride |